C40H56O22 — CID 146628856
bis[(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate (PubChem CID 146628856) has the molecular formula C40H56O22 and a molecular weight of 888.87 g/mol. Its IUPAC name is bis[(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 146628856 |
| Molecular Formula | C40H56O22 |
| Molecular Weight | 888.87 g/mol |
| Exact Mass | 888.33 |
| IUPAC Name | bis[(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate |
| SMILES | CCC(=O)OC[C@H]1O[C@H](OC(=O)/C=C/C(=O)O[C@H]2O[C@H](COC(=O)CC)[C@@H](OC(=O)CC)[C@H](OC(=O)CC)[C@H]2OC(=O)CC)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C40H56O22/c1-9-23(41)51-19-21-33(55-25(43)11-3)35(57-27(45)13-5)37(59-29(47)15-7)39(53-21)61-31(49)17-18-32(50)62-40-38(60-30(48)16-8)36(58-28(46)14-6)34(56-26(44)12-4)22(54-40)20-52-24(42)10-2/h17-18,21-22,33-40H,9-16,19-20H2,1-8H3/b18-17+/t21-,22-,33-,34-,35+,36+,37-,38-,39-,40-/m1/s1 |
| InChIKey | LDNSFUILBWJERZ-PBJBVUPMSA-N |
| XLogP | 1.92 |
| TPSA | 281.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|