C22H30O13 — CID 146628883
(E)-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid (PubChem CID 146628883) has the molecular formula C22H30O13 and a molecular weight of 502.47 g/mol. Its IUPAC name is (E)-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 146628883 |
| Molecular Formula | C22H30O13 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (E)-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](OC(=O)/C=C/C(=O)O)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C22H30O13/c1-5-14(25)30-11-12-19(32-15(26)6-2)20(33-16(27)7-3)21(34-17(28)8-4)22(31-12)35-18(29)10-9-13(23)24/h9-10,12,19-22H,5-8,11H2,1-4H3,(H,23,24)/b10-9+/t12-,19+,20+,21-,22+/m1/s1 |
| InChIKey | QLRAWRDFPCWPHG-STHBTUIKSA-N |
| XLogP | 0.81 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|