C29H35NO11 — CID 146662864
[(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate (PubChem CID 146662864) has the molecular formula C29H35NO11 and a molecular weight of 573.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 146662864 |
| Molecular Formula | C29H35NO11 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate |
| SMILES | CCC(=O)OC[C@H]1O[C@H](OC(=O)/C=C/c2c[nH]c3ccccc23)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C29H35NO11/c1-5-21(31)36-16-20-26(38-22(32)6-2)27(39-23(33)7-3)28(40-24(34)8-4)29(37-20)41-25(35)14-13-17-15-30-19-12-10-9-11-18(17)19/h9-15,20,26-30H,5-8,16H2,1-4H3/b14-13+/t20-,26-,27+,28-,29-/m1/s1 |
| InChIKey | GNQVFPFTFBHTIP-WXKKXIACSA-N |
| XLogP | 3.37 |
| TPSA | 156.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|