About 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate
2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate (PubChem CID 163135142) has the molecular formula C21H16N2O2
and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate |
| PubChem CID | 163135142 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1c[nH]c2ccccc12)OC=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H16N2O2/c24-21(10-9-15-13-22-19-7-3-1-5-17(15)19)25-12-11-16-14-23-20-8-4-2-6-18(16)20/h1-14,22-23H |
| InChIKey | HQVWXHZUQHEJTO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate?
The IUPAC name of 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate (CID 163135142) is 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate.
What is the SMILES notation for 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate?
The canonical SMILES for 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate is O=C(C=Cc1c[nH]c2ccccc12)OC=Cc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate?
The InChIKey is HQVWXHZUQHEJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c24-21(10-9-15-13-22-19-7-3-1-5-17(15)19)25-12-11-16-14-23-20-8-4-2-6-18(16)20/h1-14,22-23H.
What are the key properties of 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate?
2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate has a molecular weight of 328.37 g/mol, XLogP of 4.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)ethenyl 3-(1H-indol-3-yl)prop-2-enoate is sourced from PubChem (CID 163135142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).