C10H7Br2N — CID 130532177
3-(2,2-dibromoethenyl)-1H-indole (PubChem CID 130532177) has the molecular formula C10H7Br2N and a molecular weight of 300.98 g/mol. Its IUPAC name is 3-(2,2-dibromoethenyl)-1H-indole.
| Compound Name | 3-(2,2-dibromoethenyl)-1H-indole |
|---|---|
| PubChem CID | 130532177 |
| Molecular Formula | C10H7Br2N |
| Molecular Weight | 300.98 g/mol |
| Exact Mass | 298.89 |
| IUPAC Name | 3-(2,2-dibromoethenyl)-1H-indole |
| SMILES | BrC(Br)=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H7Br2N/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-6,13H |
| InChIKey | QPVSHSFRGCUHSU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |