C23H18N2O — CID 716705
(2E)-2,5-bis(1H-indol-3-ylmethylidene)cyclopentan-1-one (PubChem CID 716705) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is (2E)-2,5-bis(1H-indol-3-ylmethylidene)cyclopentan-1-one.
| Compound Name | (2E)-2,5-bis(1H-indol-3-ylmethylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 716705 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2E)-2,5-bis(1H-indol-3-ylmethylidene)cyclopentan-1-one |
| SMILES | O=C1C(=Cc2c[nH]c3ccccc23)CC/C1=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H18N2O/c26-23-15(11-17-13-24-21-7-3-1-5-19(17)21)9-10-16(23)12-18-14-25-22-8-4-2-6-20(18)22/h1-8,11-14,24-25H,9-10H2/b15-11+,16-12? |
| InChIKey | XWKQDPZDSGUBDK-XTZWMPCRSA-N |
| XLogP | 5.48 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|