C20H21NO2 — CID 68967121
(3E,4aS,5S)-5-hydroxy-3-(1H-indol-3-ylmethylidene)-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68967121) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3E,4aS,5S)-5-hydroxy-3-(1H-indol-3-ylmethylidene)-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-5-hydroxy-3-(1H-indol-3-ylmethylidene)-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68967121 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3E,4aS,5S)-5-hydroxy-3-(1H-indol-3-ylmethylidene)-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C[C@]12C/C(=C\c3c[nH]c4ccccc34)C(=O)C=C1CCC[C@@H]2O |
| InChI | InChI=1S/C20H21NO2/c1-20-11-13(18(22)10-15(20)5-4-8-19(20)23)9-14-12-21-17-7-3-2-6-16(14)17/h2-3,6-7,9-10,12,19,21,23H,4-5,8,11H2,1H3/b13-9+/t19-,20-/m0/s1 |
| InChIKey | MPJBMQCZOSLSAW-PBBIBXJJSA-N |
| XLogP | 4.00 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|