C22H21N3O — CID 3553271
3a-[2-(1H-indol-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one (PubChem CID 3553271) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 3a-[2-(1H-indol-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one.
| Compound Name | 3a-[2-(1H-indol-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 3553271 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3a-[2-(1H-indol-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
| SMILES | CC1(C)c2ccccc2N2CC(=O)NC21C=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3O/c1-21(2)17-8-4-6-10-19(17)25-14-20(26)24-22(21,25)12-11-15-13-23-18-9-5-3-7-16(15)18/h3-13,23H,14H2,1-2H3,(H,24,26) |
| InChIKey | WCUQBPHRWXOCRN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|