C18H14N2O2 — CID 19041959
(6E)-6-(1H-indol-3-ylmethylidene)-4,7-dihydroisoquinoline-1,3-dione (PubChem CID 19041959) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is (6E)-6-(1H-indol-3-ylmethylidene)-4,7-dihydroisoquinoline-1,3-dione.
| Compound Name | (6E)-6-(1H-indol-3-ylmethylidene)-4,7-dihydroisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 19041959 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (6E)-6-(1H-indol-3-ylmethylidene)-4,7-dihydroisoquinoline-1,3-dione |
| SMILES | O=C1CC2=C/C(=C/c3c[nH]c4ccccc34)CC=C2C(=O)N1 |
| InChI | InChI=1S/C18H14N2O2/c21-17-9-12-7-11(5-6-15(12)18(22)20-17)8-13-10-19-16-4-2-1-3-14(13)16/h1-4,6-8,10,19H,5,9H2,(H,20,21,22)/b11-8+ |
| InChIKey | VJUQCGZWLKLYKK-DHZHZOJOSA-N |
| XLogP | 2.85 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|