About 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid
1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid (PubChem CID 87759700) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid |
| PubChem CID | 87759700 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccccc12.O=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H7NO2.C9H7NO/c11-9(12)7-5-10-8-4-2-1-3-6(7)8;11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,10H,(H,11,12);1-6,10H |
| InChIKey | LEIFKRCDLQWDEZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid?
The IUPAC name of 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid (CID 87759700) is 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid.
What is the SMILES notation for 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid?
The canonical SMILES for 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid is O=C(O)c1c[nH]c2ccccc12.O=Cc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid?
The InChIKey is LEIFKRCDLQWDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C9H7NO/c11-9(12)7-5-10-8-4-2-1-3-6(7)8;11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,10H,(H,11,12);1-6,10H.
What are the key properties of 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid?
1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid has a molecular weight of 306.32 g/mol, XLogP of 3.85, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-3-carbaldehyde;1H-indole-3-carboxylic acid is sourced from PubChem (CID 87759700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).