About 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone
1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone (PubChem CID 174483590) has the molecular formula C29H25N3O3
and a molecular weight of 463.54 g/mol. Its IUPAC name is 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone |
| PubChem CID | 174483590 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2ccccc12.CC(=O)n1ccc2ccccc21.O=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/2C10H9NO.C9H7NO/c1-8(12)11-7-6-9-4-2-3-5-10(9)11;1-7(12)9-6-11-10-5-3-2-4-8(9)10;11-6-7-5-10-9-4-2-1-3-8(7)9/h2-7H,1H3;2-6,11H,1H3;1-6,10H |
| InChIKey | XTQIHUGVBACOBE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone?
The IUPAC name of 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone (CID 174483590) is 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone.
What is the SMILES notation for 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone?
The canonical SMILES for 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone is CC(=O)c1c[nH]c2ccccc12.CC(=O)n1ccc2ccccc21.O=Cc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone?
The InChIKey is XTQIHUGVBACOBE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9NO.C9H7NO/c1-8(12)11-7-6-9-4-2-3-5-10(9)11;1-7(12)9-6-11-10-5-3-2-4-8(9)10;11-6-7-5-10-9-4-2-1-3-8(7)9/h2-7H,1H3;2-6,11H,1H3;1-6,10H.
What are the key properties of 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone?
1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone has a molecular weight of 463.54 g/mol, XLogP of 6.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-3-carbaldehyde;1-indol-1-ylethanone;1-(1H-indol-3-yl)ethanone is sourced from PubChem (CID 174483590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).