C13H15NO2 — CID 90885148
ethane;1-(1H-indol-3-yl)propane-1,2-dione (PubChem CID 90885148) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is ethane;1-(1H-indol-3-yl)propane-1,2-dione.
| Compound Name | ethane;1-(1H-indol-3-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 90885148 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethane;1-(1H-indol-3-yl)propane-1,2-dione |
| SMILES | CC.CC(=O)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H9NO2.C2H6/c1-7(13)11(14)9-6-12-10-5-3-2-4-8(9)10;1-2/h2-6,12H,1H3;1-2H3 |
| InChIKey | NGEGHKWQDWLCPV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|