C12H12F3NO — CID 91288381
ethane;2,2,2-trifluoro-1-(1H-indol-3-yl)ethanone (PubChem CID 91288381) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-1-(1H-indol-3-yl)ethanone.
| Compound Name | ethane;2,2,2-trifluoro-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 91288381 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethane;2,2,2-trifluoro-1-(1H-indol-3-yl)ethanone |
| SMILES | CC.O=C(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C10H6F3NO.C2H6/c11-10(12,13)9(15)7-5-14-8-4-2-1-3-6(7)8;1-2/h1-5,14H;1-2H3 |
| InChIKey | GQEXCLOAEAPFIM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |