C12H8F3NO — CID 23240219
(Z)-4,4,4-trifluoro-3-(1H-indol-3-yl)but-2-enal (PubChem CID 23240219) has the molecular formula C12H8F3NO and a molecular weight of 239.20 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-(1H-indol-3-yl)but-2-enal.
| Compound Name | (Z)-4,4,4-trifluoro-3-(1H-indol-3-yl)but-2-enal |
|---|---|
| PubChem CID | 23240219 |
| Molecular Formula | C12H8F3NO |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-(1H-indol-3-yl)but-2-enal |
| SMILES | O=C/C=C(/c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C12H8F3NO/c13-12(14,15)10(5-6-17)9-7-16-11-4-2-1-3-8(9)11/h1-7,16H/b10-5- |
| InChIKey | KKHPEQMTQDZGAZ-YHYXMXQVSA-N |
| XLogP | 3.31 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|