About sodium 1H-indole-3-carboxylate
sodium 1H-indole-3-carboxylate (PubChem CID 23698293) has the molecular formula C9H6NNaO2
and a molecular weight of 183.14 g/mol. Its IUPAC name is sodium 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | sodium 1H-indole-3-carboxylate |
| PubChem CID | 23698293 |
| Molecular Formula | C9H6NNaO2 |
| Molecular Weight | 183.14 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | sodium 1H-indole-3-carboxylate |
| SMILES | O=C([O-])c1c[nH]c2ccccc12.[Na+] |
| InChI | InChI=1S/C9H7NO2.Na/c11-9(12)7-5-10-8-4-2-1-3-6(7)8;/h1-5,10H,(H,11,12);/q;+1/p-1 |
| InChIKey | XTNBVKGEHGUUEO-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.14 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1H-indole-3-carboxylate?
The IUPAC name of sodium 1H-indole-3-carboxylate (CID 23698293) is sodium 1H-indole-3-carboxylate.
What is the SMILES notation for sodium 1H-indole-3-carboxylate?
The canonical SMILES for sodium 1H-indole-3-carboxylate is O=C([O-])c1c[nH]c2ccccc12.[Na+].
What is the InChIKey of sodium 1H-indole-3-carboxylate?
The InChIKey is XTNBVKGEHGUUEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NO2.Na/c11-9(12)7-5-10-8-4-2-1-3-6(7)8;/h1-5,10H,(H,11,12);/q;+1/p-1.
What are the key properties of sodium 1H-indole-3-carboxylate?
sodium 1H-indole-3-carboxylate has a molecular weight of 183.14 g/mol, XLogP of -2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1H-indole-3-carboxylate is sourced from PubChem (CID 23698293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).