C13H13F3N2O — CID 61381226
N-methyl-N-(3,3,3-trifluoropropyl)-1H-indole-3-carboxamide (PubChem CID 61381226) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is N-methyl-N-(3,3,3-trifluoropropyl)-1H-indole-3-carboxamide.
| Compound Name | N-methyl-N-(3,3,3-trifluoropropyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 61381226 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-methyl-N-(3,3,3-trifluoropropyl)-1H-indole-3-carboxamide |
| SMILES | CN(CCC(F)(F)F)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H13F3N2O/c1-18(7-6-13(14,15)16)12(19)10-8-17-11-5-3-2-4-9(10)11/h2-5,8,17H,6-7H2,1H3 |
| InChIKey | LWNYXQWJQQDXHM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |