C12H11ClF3NO — CID 145106752
1-(4-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone;ethane (PubChem CID 145106752) has the molecular formula C12H11ClF3NO and a molecular weight of 277.67 g/mol. Its IUPAC name is 1-(4-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone;ethane.
| Compound Name | 1-(4-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone;ethane |
|---|---|
| PubChem CID | 145106752 |
| Molecular Formula | C12H11ClF3NO |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-(4-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone;ethane |
| SMILES | CC.O=C(c1c[nH]c2cccc(Cl)c12)C(F)(F)F |
| InChI | InChI=1S/C10H5ClF3NO.C2H6/c11-6-2-1-3-7-8(6)5(4-15-7)9(16)10(12,13)14;1-2/h1-4,15H;1-2H3 |
| InChIKey | IBZVQAFFRIUQJL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |