C16H18ClNO — CID 107176610
(4-chloro-1H-indol-3-yl)-(2,2-dimethylcyclopentyl)methanone (PubChem CID 107176610) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is (4-chloro-1H-indol-3-yl)-(2,2-dimethylcyclopentyl)methanone.
| Compound Name | (4-chloro-1H-indol-3-yl)-(2,2-dimethylcyclopentyl)methanone |
|---|---|
| PubChem CID | 107176610 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (4-chloro-1H-indol-3-yl)-(2,2-dimethylcyclopentyl)methanone |
| SMILES | CC1(C)CCCC1C(=O)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C16H18ClNO/c1-16(2)8-4-5-11(16)15(19)10-9-18-13-7-3-6-12(17)14(10)13/h3,6-7,9,11,18H,4-5,8H2,1-2H3 |
| InChIKey | OHAJSASZWAZTGJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |