C16H17ClF2N2O — CID 160755750
4-chloro-N-[(3,3-difluorocyclohexyl)methyl]-1H-indole-3-carboxamide (PubChem CID 160755750) has the molecular formula C16H17ClF2N2O and a molecular weight of 326.77 g/mol. Its IUPAC name is 4-chloro-N-[(3,3-difluorocyclohexyl)methyl]-1H-indole-3-carboxamide.
| Compound Name | 4-chloro-N-[(3,3-difluorocyclohexyl)methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 160755750 |
| Molecular Formula | C16H17ClF2N2O |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-chloro-N-[(3,3-difluorocyclohexyl)methyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCC1CCCC(F)(F)C1)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C16H17ClF2N2O/c17-12-4-1-5-13-14(12)11(9-20-13)15(22)21-8-10-3-2-6-16(18,19)7-10/h1,4-5,9-10,20H,2-3,6-8H2,(H,21,22) |
| InChIKey | RXKDTOLBWZYSKF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |