C17H20ClNO — CID 107176419
(6-chloro-1H-indol-3-yl)-(2,2-dimethylcyclohexyl)methanone (PubChem CID 107176419) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is (6-chloro-1H-indol-3-yl)-(2,2-dimethylcyclohexyl)methanone.
| Compound Name | (6-chloro-1H-indol-3-yl)-(2,2-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 107176419 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (6-chloro-1H-indol-3-yl)-(2,2-dimethylcyclohexyl)methanone |
| SMILES | CC1(C)CCCCC1C(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H20ClNO/c1-17(2)8-4-3-5-14(17)16(20)13-10-19-15-9-11(18)6-7-12(13)15/h6-7,9-10,14,19H,3-5,8H2,1-2H3 |
| InChIKey | HWNUPMAPKUKBNA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |