C16H17NO — CID 23427115
(3E,5E)-6-(1H-indol-3-yl)-5-methylhepta-3,5-dien-2-one (PubChem CID 23427115) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (3E,5E)-6-(1H-indol-3-yl)-5-methylhepta-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-(1H-indol-3-yl)-5-methylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 23427115 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (3E,5E)-6-(1H-indol-3-yl)-5-methylhepta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C(C)=C(\C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H17NO/c1-11(8-9-12(2)18)13(3)15-10-17-16-7-5-4-6-14(15)16/h4-10,17H,1-3H3/b9-8+,13-11+ |
| InChIKey | XYPNIPPMKPLGOZ-VKTMSVCMSA-N |
| XLogP | 4.11 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|