C14H13NO2 — CID 116822539
(2E,4E)-5-(1H-indol-3-yl)hexa-2,4-dienoic acid (PubChem CID 116822539) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2E,4E)-5-(1H-indol-3-yl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(1H-indol-3-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822539 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (2E,4E)-5-(1H-indol-3-yl)hexa-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\C(=O)O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H13NO2/c1-10(5-4-8-14(16)17)12-9-15-13-7-3-2-6-11(12)13/h2-9,15H,1H3,(H,16,17)/b8-4+,10-5+ |
| InChIKey | LJALIEUWQVLJMV-DXNUHORPSA-N |
| XLogP | 3.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|