C21H19N3 — CID 142337439
(E)-1,3-bis(1H-indol-3-yl)-N-methylbut-2-en-1-imine (PubChem CID 142337439) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (E)-1,3-bis(1H-indol-3-yl)-N-methylbut-2-en-1-imine.
| Compound Name | (E)-1,3-bis(1H-indol-3-yl)-N-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142337439 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (E)-1,3-bis(1H-indol-3-yl)-N-methylbut-2-en-1-imine |
| SMILES | C/N=C(\C=C(/C)c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19N3/c1-14(17-12-23-19-9-5-3-7-15(17)19)11-21(22-2)18-13-24-20-10-6-4-8-16(18)20/h3-13,23-24H,1-2H3/b14-11+,22-21+ |
| InChIKey | HANUDFXPUYEZMD-LOINWKKQSA-N |
| XLogP | 5.17 |
| TPSA | 43.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|