C14H14ClN3 — CID 134556390
N'-[(1E)-2-chloro-3-(1H-indol-3-yl)buta-1,3-dienyl]ethanimidamide (PubChem CID 134556390) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is N'-[(1E)-2-chloro-3-(1H-indol-3-yl)buta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E)-2-chloro-3-(1H-indol-3-yl)buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 134556390 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N'-[(1E)-2-chloro-3-(1H-indol-3-yl)buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C(Cl)=C\N=C(/C)N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14ClN3/c1-9(13(15)8-17-10(2)16)12-7-18-14-6-4-3-5-11(12)14/h3-8,18H,1H2,2H3,(H2,16,17)/b13-8+ |
| InChIKey | MXVFAAAQZYYNQL-MDWZMJQESA-N |
| XLogP | 3.64 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|