C19H27N3O2 — CID 143161684
N-[(2E)-4-aminopenta-2,4-dien-2-yl]-4-oxo-1H-quinoline-3-carboxamide;ethane (PubChem CID 143161684) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[(2E)-4-aminopenta-2,4-dien-2-yl]-4-oxo-1H-quinoline-3-carboxamide;ethane.
| Compound Name | N-[(2E)-4-aminopenta-2,4-dien-2-yl]-4-oxo-1H-quinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143161684 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[(2E)-4-aminopenta-2,4-dien-2-yl]-4-oxo-1H-quinoline-3-carboxamide;ethane |
| SMILES | C=C(N)/C=C(\C)NC(=O)c1c[nH]c2ccccc2c1=O.CC.CC |
| InChI | InChI=1S/C15H15N3O2.2C2H6/c1-9(16)7-10(2)18-15(20)12-8-17-13-6-4-3-5-11(13)14(12)19;2*1-2/h3-8H,1,16H2,2H3,(H,17,19)(H,18,20);2*1-2H3/b10-7+;; |
| InChIKey | DMAMQERTXVNONB-WRQJSNHTSA-N |
| XLogP | 3.69 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|