C19H21N3O2 — CID 143161648
N-[(3E)-5-amino-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 143161648) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(3E)-5-amino-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(3E)-5-amino-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 143161648 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(3E)-5-amino-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | C=C(C)/C(=C\C(N)=C(C)C)NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C19H21N3O2/c1-11(2)15(20)9-17(12(3)4)22-19(24)14-10-21-16-8-6-5-7-13(16)18(14)23/h5-10H,3,20H2,1-2,4H3,(H,21,23)(H,22,24)/b17-9+ |
| InChIKey | MWBULFDYTDODDN-RQZCQDPDSA-N |
| XLogP | 2.97 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|