C16H20N2O3 — CID 61246049
N-(1-hydroxy-4-methylpentan-2-yl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 61246049) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-2-yl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-2-yl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 61246049 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-2-yl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC(C)CC(CO)NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)7-11(9-19)18-16(21)13-8-17-14-6-4-3-5-12(14)15(13)20/h3-6,8,10-11,19H,7,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | OGHBARCFDVKYRI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |