C15H18N2O4 — CID 107866584
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 107866584) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 107866584 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C15H18N2O4/c1-2-15(8-18,9-19)17-14(21)11-7-16-12-6-4-3-5-10(12)13(11)20/h3-7,18-19H,2,8-9H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | DEHTZJBWPHYDCG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |