C22H28N2O2 — CID 90785095
ethane;N-(2-methylphenyl)-4-oxo-1H-quinoline-3-carboxamide;propane (PubChem CID 90785095) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethane;N-(2-methylphenyl)-4-oxo-1H-quinoline-3-carboxamide;propane.
| Compound Name | ethane;N-(2-methylphenyl)-4-oxo-1H-quinoline-3-carboxamide;propane |
|---|---|
| PubChem CID | 90785095 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethane;N-(2-methylphenyl)-4-oxo-1H-quinoline-3-carboxamide;propane |
| SMILES | CC.CCC.Cc1ccccc1NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H14N2O2.C3H8.C2H6/c1-11-6-2-4-8-14(11)19-17(21)13-10-18-15-9-5-3-7-12(15)16(13)20;1-3-2;1-2/h2-10H,1H3,(H,18,20)(H,19,21);3H2,1-2H3;1-2H3 |
| InChIKey | YVZRUTMUGBTOHN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |