C20H14N2O3 — CID 66675664
N-[2-(furan-3-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 66675664) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[2-(furan-3-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-(furan-3-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 66675664 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-(furan-3-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccoc1)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H14N2O3/c23-19-15-6-2-3-7-17(15)21-11-16(19)20(24)22-18-8-4-1-5-14(18)13-9-10-25-12-13/h1-12H,(H,21,23)(H,22,24) |
| InChIKey | HGAAUJDFZLUOEB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |