C24H27N3O2 — CID 66675127
N-[2-[(cyclohexylmethylamino)methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 66675127) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[2-[(cyclohexylmethylamino)methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[(cyclohexylmethylamino)methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 66675127 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[2-[(cyclohexylmethylamino)methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1ccccc1CNCC1CCCCC1)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C24H27N3O2/c28-23-19-11-5-7-13-22(19)26-16-20(23)24(29)27-21-12-6-4-10-18(21)15-25-14-17-8-2-1-3-9-17/h4-7,10-13,16-17,25H,1-3,8-9,14-15H2,(H,26,28)(H,27,29) |
| InChIKey | GSLRWDRMBQLEGA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |