C24H27N3O2 — CID 66675128
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 66675128) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 66675128 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CN(Cc1ccccc1NC(=O)c1c[nH]c2ccccc2c1=O)C1CCCCC1 |
| InChI | InChI=1S/C24H27N3O2/c1-27(18-10-3-2-4-11-18)16-17-9-5-7-13-21(17)26-24(29)20-15-25-22-14-8-6-12-19(22)23(20)28/h5-9,12-15,18H,2-4,10-11,16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | GOSSSUWOAWIHOR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |