C25H31N3O2 — CID 78873256
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-2-(5-methoxy-1H-indol-3-yl)acetamide (PubChem CID 78873256) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-2-(5-methoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 78873256 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)Nc3ccccc3CN(C)C3CCCCC3)c2c1 |
| InChI | InChI=1S/C25H31N3O2/c1-28(20-9-4-3-5-10-20)17-18-8-6-7-11-23(18)27-25(29)14-19-16-26-24-13-12-21(30-2)15-22(19)24/h6-8,11-13,15-16,20,26H,3-5,9-10,14,17H2,1-2H3,(H,27,29) |
| InChIKey | VPBKQLRYDBRRMZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |