C24H28N2O3 — CID 60614816
N-[(4-cyclohexyloxyphenyl)methyl]-2-(5-methoxy-1H-indol-3-yl)acetamide (PubChem CID 60614816) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[(4-cyclohexyloxyphenyl)methyl]-2-(5-methoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[(4-cyclohexyloxyphenyl)methyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 60614816 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[(4-cyclohexyloxyphenyl)methyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)NCc3ccc(OC4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C24H28N2O3/c1-28-21-11-12-23-22(14-21)18(16-25-23)13-24(27)26-15-17-7-9-20(10-8-17)29-19-5-3-2-4-6-19/h7-12,14,16,19,25H,2-6,13,15H2,1H3,(H,26,27) |
| InChIKey | XZJCQAOWRCRRHC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |