C18H21F3N2O2 — CID 86985838
2-(5-methoxy-1H-indol-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 86985838) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 86985838 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)NC3CCCC(C(F)(F)F)C3)c2c1 |
| InChI | InChI=1S/C18H21F3N2O2/c1-25-14-5-6-16-15(9-14)11(10-22-16)7-17(24)23-13-4-2-3-12(8-13)18(19,20)21/h5-6,9-10,12-13,22H,2-4,7-8H2,1H3,(H,23,24) |
| InChIKey | IYVDDFQHQFWFFJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |