C22H27F3N4O2 — CID 55922858
4-[2-(1H-indol-3-yl)acetyl]-N-[3-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide (PubChem CID 55922858) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)acetyl]-N-[3-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(1H-indol-3-yl)acetyl]-N-[3-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55922858 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)acetyl]-N-[3-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCN(C(=O)NC2CCCC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C22H27F3N4O2/c23-22(24,25)16-4-3-5-17(13-16)27-21(31)29-10-8-28(9-11-29)20(30)12-15-14-26-19-7-2-1-6-18(15)19/h1-2,6-7,14,16-17,26H,3-5,8-13H2,(H,27,31) |
| InChIKey | RNKAJAKJQWFGJF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |