C20H28F3IN4 — CID 111984168
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 111984168) has the molecular formula C20H28F3IN4 and a molecular weight of 508.37 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111984168 |
| Molecular Formula | C20H28F3IN4 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCCC(C(F)(F)F)C1.I |
| InChI | InChI=1S/C20H27F3N4.HI/c1-24-19(27-16-8-4-7-15(12-16)20(21,22)23)25-11-5-6-14-13-26-18-10-3-2-9-17(14)18;/h2-3,9-10,13,15-16,26H,4-8,11-12H2,1H3,(H2,24,25,27);1H |
| InChIKey | WMQWAJDNTGFHRZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|