C20H29N5O2 — CID 111984563
methyl 4-[[N-[3-(1H-indol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111984563) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is methyl 4-[[N-[3-(1H-indol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[N-[3-(1H-indol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111984563 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | methyl 4-[[N-[3-(1H-indol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H29N5O2/c1-21-19(24-16-9-12-25(13-10-16)20(26)27-2)22-11-5-6-15-14-23-18-8-4-3-7-17(15)18/h3-4,7-8,14,16,23H,5-6,9-13H2,1-2H3,(H2,21,22,24) |
| InChIKey | GCXDYXQKKBKUHE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|