C21H32N4OS — CID 109439447
1-(3-ethylsulfinylcyclohexyl)-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine (PubChem CID 109439447) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109439447 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C21H32N4OS/c1-3-27(26)18-10-6-9-17(14-18)25-21(22-2)23-13-7-8-16-15-24-20-12-5-4-11-19(16)20/h4-5,11-12,15,17-18,24H,3,6-10,13-14H2,1-2H3,(H2,22,23,25) |
| InChIKey | AIQKMGORIWYIGU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|