C22H34N4OS — CID 109440287
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(1H-indol-3-yl)propyl]guanidine (PubChem CID 109440287) has the molecular formula C22H34N4OS and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(1H-indol-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(1H-indol-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109440287 |
| Molecular Formula | C22H34N4OS |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(1H-indol-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1c[nH]c2ccccc12)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C22H34N4OS/c1-3-23-22(26-18-10-7-11-19(15-18)28(27)4-2)24-14-8-9-17-16-25-21-13-6-5-12-20(17)21/h5-6,12-13,16,18-19,25H,3-4,7-11,14-15H2,1-2H3,(H2,23,24,26) |
| InChIKey | CQJRIVRMOFPDIQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|