C19H28IN5O — CID 111984624
1-ethyl-2-[3-(1H-indol-3-yl)propyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide (PubChem CID 111984624) has the molecular formula C19H28IN5O and a molecular weight of 469.37 g/mol. Its IUPAC name is 1-ethyl-2-[3-(1H-indol-3-yl)propyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(1H-indol-3-yl)propyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111984624 |
| Molecular Formula | C19H28IN5O |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 1-ethyl-2-[3-(1H-indol-3-yl)propyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1c[nH]c2ccccc12)NC1CCC(=O)NC1.I |
| InChI | InChI=1S/C19H27N5O.HI/c1-2-20-19(24-15-9-10-18(25)23-13-15)21-11-5-6-14-12-22-17-8-4-3-7-16(14)17;/h3-4,7-8,12,15,22H,2,5-6,9-11,13H2,1H3,(H,23,25)(H2,20,21,24);1H |
| InChIKey | VSHURVJAEUOCDC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|