C25H33FIN5 — CID 111984252
1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111984252) has the molecular formula C25H33FIN5 and a molecular weight of 549.48 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111984252 |
| Molecular Formula | C25H33FIN5 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCN(Cc2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C25H32FN5.HI/c1-27-25(28-14-4-5-20-17-29-24-7-3-2-6-23(20)24)30-22-12-15-31(16-13-22)18-19-8-10-21(26)11-9-19;/h2-3,6-11,17,22,29H,4-5,12-16,18H2,1H3,(H2,27,28,30);1H |
| InChIKey | XIJSTEZZOGIDGN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|