C24H32N6 — CID 110986546
1-[3-(1H-benzimidazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine (PubChem CID 110986546) has the molecular formula C24H32N6 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 110986546 |
| Molecular Formula | C24H32N6 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCc1nc2ccccc2[nH]1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N6/c1-25-24(26-15-7-12-23-28-21-10-5-6-11-22(21)29-23)27-20-13-16-30(17-14-20)18-19-8-3-2-4-9-19/h2-6,8-11,20H,7,12-18H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | BWYIJZSRQSBFMD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|