C24H32IN5S — CID 110986531
1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine;hydroiodide (PubChem CID 110986531) has the molecular formula C24H32IN5S and a molecular weight of 549.53 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110986531 |
| Molecular Formula | C24H32IN5S |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(1-benzylpiperidin-4-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc2ccccc2s1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C24H31N5S.HI/c1-25-24(26-15-7-12-23-28-21-10-5-6-11-22(21)30-23)27-20-13-16-29(17-14-20)18-19-8-3-2-4-9-19;/h2-6,8-11,20H,7,12-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | KYXQIFRPOMXTSH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|