C24H33IN6O2 — CID 111924542
1-[3-(1H-benzimidazol-2-yl)propyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 111924542) has the molecular formula C24H33IN6O2 and a molecular weight of 564.47 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111924542 |
| Molecular Formula | C24H33IN6O2 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc2ccccc2[nH]1)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C24H32N6O2.HI/c1-25-24(26-11-6-9-23-28-21-7-4-5-8-22(21)29-23)27-17-10-12-30(16-17)18-13-19(31-2)15-20(14-18)32-3;/h4-5,7-8,13-15,17H,6,9-12,16H2,1-3H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | PHZDTHZLXAIBBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|