C23H29N5O2 — CID 111925273
1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine (PubChem CID 111925273) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111925273 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-(1H-indol-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc2ccccc2[nH]1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C23H29N5O2/c1-24-23(25-14-18-10-16-6-4-5-7-22(16)26-18)27-17-8-9-28(15-17)19-11-20(29-2)13-21(12-19)30-3/h4-7,10-13,17,26H,8-9,14-15H2,1-3H3,(H2,24,25,27) |
| InChIKey | VZHAJYBIOVNHJO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|