C21H27BrN4O2 — CID 111978572
1-[(4-bromophenyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine (PubChem CID 111978572) has the molecular formula C21H27BrN4O2 and a molecular weight of 447.38 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111978572 |
| Molecular Formula | C21H27BrN4O2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Br)cc1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C21H27BrN4O2/c1-23-21(24-13-15-4-6-16(22)7-5-15)25-17-8-9-26(14-17)18-10-19(27-2)12-20(11-18)28-3/h4-7,10-12,17H,8-9,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | MMNMBKIMQAUVDA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|