C20H27ClIN5O2 — CID 111925510
1-[(6-chloro-3-pyridinyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 111925510) has the molecular formula C20H27ClIN5O2 and a molecular weight of 531.83 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111925510 |
| Molecular Formula | C20H27ClIN5O2 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)nc1)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C20H26ClN5O2.HI/c1-22-20(24-12-14-4-5-19(21)23-11-14)25-15-6-7-26(13-15)16-8-17(27-2)10-18(9-16)28-3;/h4-5,8-11,15H,6-7,12-13H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | QUTGCFUSMAWZOC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|