C22H31ClIN5O2 — CID 109387590
2-[(6-chloro-3-pyridinyl)methyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide (PubChem CID 109387590) has the molecular formula C22H31ClIN5O2 and a molecular weight of 559.88 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109387590 |
| Molecular Formula | C22H31ClIN5O2 |
| Molecular Weight | 559.88 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H30ClN5O2.HI/c1-4-24-22(26-15-16-5-6-21(23)25-14-16)27-17-7-9-28(10-8-17)18-11-19(29-2)13-20(12-18)30-3;/h5-6,11-14,17H,4,7-10,15H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | ZVMLCQLBUCFVQQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|