C22H34IN5O2S — CID 109387266
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109387266) has the molecular formula C22H34IN5O2S and a molecular weight of 559.52 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109387266 |
| Molecular Formula | C22H34IN5O2S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)s1)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H33N5O2S.HI/c1-6-23-22(24-14-21-25-15(2)16(3)30-21)26-17-7-9-27(10-8-17)18-11-19(28-4)13-20(12-18)29-5;/h11-13,17H,6-10,14H2,1-5H3,(H2,23,24,26);1H |
| InChIKey | QIWRTKVCBZMFTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|